C13H19N5 — CID 62351659
N-[[6-(4,5-dimethylimidazol-1-yl)pyridazin-3-yl]methyl]propan-1-amine (PubChem CID 62351659) has the molecular formula C13H19N5 and a molecular weight of 245.33 g/mol. Its IUPAC name is N-[[6-(4,5-dimethylimidazol-1-yl)pyridazin-3-yl]methyl]propan-1-amine.
| Compound Name | N-[[6-(4,5-dimethylimidazol-1-yl)pyridazin-3-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 62351659 |
| Molecular Formula | C13H19N5 |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | N-[[6-(4,5-dimethylimidazol-1-yl)pyridazin-3-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1ccc(-n2cnc(C)c2C)nn1 |
| InChI | InChI=1S/C13H19N5/c1-4-7-14-8-12-5-6-13(17-16-12)18-9-15-10(2)11(18)3/h5-6,9,14H,4,7-8H2,1-3H3 |
| InChIKey | MPPHACIYYJZTQT-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|