C12H11BrClF3N2O — CID 62352193
5-bromo-6-(1-chloro-3,3,3-trifluoropropyl)-1,3-dimethylbenzimidazol-2-one (PubChem CID 62352193) has the molecular formula C12H11BrClF3N2O and a molecular weight of 371.58 g/mol. Its IUPAC name is 5-bromo-6-(1-chloro-3,3,3-trifluoropropyl)-1,3-dimethylbenzimidazol-2-one.
| Compound Name | 5-bromo-6-(1-chloro-3,3,3-trifluoropropyl)-1,3-dimethylbenzimidazol-2-one |
|---|---|
| PubChem CID | 62352193 |
| Molecular Formula | C12H11BrClF3N2O |
| Molecular Weight | 371.58 g/mol |
| Exact Mass | 369.97 |
| IUPAC Name | 5-bromo-6-(1-chloro-3,3,3-trifluoropropyl)-1,3-dimethylbenzimidazol-2-one |
| SMILES | Cn1c(=O)n(C)c2cc(C(Cl)CC(F)(F)F)c(Br)cc21 |
| InChI | InChI=1S/C12H11BrClF3N2O/c1-18-9-3-6(8(14)5-12(15,16)17)7(13)4-10(9)19(2)11(18)20/h3-4,8H,5H2,1-2H3 |
| InChIKey | KCQXMHASNMVJDC-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 26.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.58 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|