About 3-propylpiperazin-2-one
3-propylpiperazin-2-one (PubChem CID 62352457) has the molecular formula C7H14N2O
and a molecular weight of 142.20 g/mol. Its IUPAC name is 3-propylpiperazin-2-one.
Molecular Properties
| Compound Name | 3-propylpiperazin-2-one |
| PubChem CID | 62352457 |
| Molecular Formula | C7H14N2O |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.11 |
| IUPAC Name | 3-propylpiperazin-2-one |
| SMILES | CCCC1NCCNC1=O |
| InChI | InChI=1S/C7H14N2O/c1-2-3-6-7(10)9-5-4-8-6/h6,8H,2-5H2,1H3,(H,9,10) |
| InChIKey | XEYKZRANLMUCSI-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-propylpiperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propylpiperazin-2-one?
The IUPAC name of 3-propylpiperazin-2-one (CID 62352457) is 3-propylpiperazin-2-one.
What is the SMILES notation for 3-propylpiperazin-2-one?
The canonical SMILES for 3-propylpiperazin-2-one is CCCC1NCCNC1=O.
What is the InChIKey of 3-propylpiperazin-2-one?
The InChIKey is XEYKZRANLMUCSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O/c1-2-3-6-7(10)9-5-4-8-6/h6,8H,2-5H2,1H3,(H,9,10).
What are the key properties of 3-propylpiperazin-2-one?
3-propylpiperazin-2-one has a molecular weight of 142.20 g/mol, XLogP of -0.13, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propylpiperazin-2-one is sourced from PubChem (CID 62352457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).