About 3-(3,5-dimethylphenyl)-2,2-dimethylpyrrolidine
3-(3,5-dimethylphenyl)-2,2-dimethylpyrrolidine (PubChem CID 62354775) has the molecular formula C14H21N
and a molecular weight of 203.33 g/mol. Its IUPAC name is 3-(3,5-dimethylphenyl)-2,2-dimethylpyrrolidine.
Molecular Properties
| Compound Name | 3-(3,5-dimethylphenyl)-2,2-dimethylpyrrolidine |
| PubChem CID | 62354775 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 3-(3,5-dimethylphenyl)-2,2-dimethylpyrrolidine |
| SMILES | Cc1cc(C)cc(C2CCNC2(C)C)c1 |
| InChI | InChI=1S/C14H21N/c1-10-7-11(2)9-12(8-10)13-5-6-15-14(13,3)4/h7-9,13,15H,5-6H2,1-4H3 |
| InChIKey | XQQDLEVKJKUPAK-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(3,5-dimethylphenyl)-2,2-dimethylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-dimethylphenyl)-2,2-dimethylpyrrolidine?
The IUPAC name of 3-(3,5-dimethylphenyl)-2,2-dimethylpyrrolidine (CID 62354775) is 3-(3,5-dimethylphenyl)-2,2-dimethylpyrrolidine.
What is the SMILES notation for 3-(3,5-dimethylphenyl)-2,2-dimethylpyrrolidine?
The canonical SMILES for 3-(3,5-dimethylphenyl)-2,2-dimethylpyrrolidine is Cc1cc(C)cc(C2CCNC2(C)C)c1.
What is the InChIKey of 3-(3,5-dimethylphenyl)-2,2-dimethylpyrrolidine?
The InChIKey is XQQDLEVKJKUPAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N/c1-10-7-11(2)9-12(8-10)13-5-6-15-14(13,3)4/h7-9,13,15H,5-6H2,1-4H3.
What are the key properties of 3-(3,5-dimethylphenyl)-2,2-dimethylpyrrolidine?
3-(3,5-dimethylphenyl)-2,2-dimethylpyrrolidine has a molecular weight of 203.33 g/mol, XLogP of 3.16, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-dimethylphenyl)-2,2-dimethylpyrrolidine is sourced from PubChem (CID 62354775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).