C20H28O3 — CID 623556
3,3,6,6-tetramethyl-9-propyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione (PubChem CID 623556) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is 3,3,6,6-tetramethyl-9-propyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione.
| Compound Name | 3,3,6,6-tetramethyl-9-propyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione |
|---|---|
| PubChem CID | 623556 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | 3,3,6,6-tetramethyl-9-propyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione |
| SMILES | CCCC1C2=C(CC(C)(C)CC2=O)OC2=C1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C20H28O3/c1-6-7-12-17-13(21)8-19(2,3)10-15(17)23-16-11-20(4,5)9-14(22)18(12)16/h12H,6-11H2,1-5H3 |
| InChIKey | WZHFRQDUQATTJI-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |