C13H15N5O2 — CID 62355697
5-[(1-methylimidazol-2-yl)methylamino]benzene-1,3-dicarboxamide (PubChem CID 62355697) has the molecular formula C13H15N5O2 and a molecular weight of 273.30 g/mol. Its IUPAC name is 5-[(1-methylimidazol-2-yl)methylamino]benzene-1,3-dicarboxamide.
| Compound Name | 5-[(1-methylimidazol-2-yl)methylamino]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 62355697 |
| Molecular Formula | C13H15N5O2 |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 5-[(1-methylimidazol-2-yl)methylamino]benzene-1,3-dicarboxamide |
| SMILES | Cn1ccnc1CNc1cc(C(N)=O)cc(C(N)=O)c1 |
| InChI | InChI=1S/C13H15N5O2/c1-18-3-2-16-11(18)7-17-10-5-8(12(14)19)4-9(6-10)13(15)20/h2-6,17H,7H2,1H3,(H2,14,19)(H2,15,20) |
| InChIKey | PWINFGLKGQTKDG-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 116.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |