C16H24BrNO3 — CID 62356314
2-[1-[(4-bromo-2,5-dimethoxyphenyl)methyl]piperidin-3-yl]ethanol (PubChem CID 62356314) has the molecular formula C16H24BrNO3 and a molecular weight of 358.28 g/mol. Its IUPAC name is 2-[1-[(4-bromo-2,5-dimethoxyphenyl)methyl]piperidin-3-yl]ethanol.
| Compound Name | 2-[1-[(4-bromo-2,5-dimethoxyphenyl)methyl]piperidin-3-yl]ethanol |
|---|---|
| PubChem CID | 62356314 |
| Molecular Formula | C16H24BrNO3 |
| Molecular Weight | 358.28 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 2-[1-[(4-bromo-2,5-dimethoxyphenyl)methyl]piperidin-3-yl]ethanol |
| SMILES | COc1cc(CN2CCCC(CCO)C2)c(OC)cc1Br |
| InChI | InChI=1S/C16H24BrNO3/c1-20-15-9-14(17)16(21-2)8-13(15)11-18-6-3-4-12(10-18)5-7-19/h8-9,12,19H,3-7,10-11H2,1-2H3 |
| InChIKey | GSARRYHBJJAAPR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.28 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |