About ethyl 1-[(E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoyl]piperidine-4-carboxylate
ethyl 1-[(E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoyl]piperidine-4-carboxylate (PubChem CID 6235647) has the molecular formula C16H18ClN3O3S
and a molecular weight of 367.86 g/mol. Its IUPAC name is ethyl 1-[(E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoyl]piperidine-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-[(E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoyl]piperidine-4-carboxylate |
| PubChem CID | 6235647 |
| Molecular Formula | C16H18ClN3O3S |
| Molecular Weight | 367.86 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | ethyl 1-[(E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)/C=C/c2c(Cl)nc3sccn23)CC1 |
| InChI | InChI=1S/C16H18ClN3O3S/c1-2-23-15(22)11-5-7-19(8-6-11)13(21)4-3-12-14(17)18-16-20(12)9-10-24-16/h3-4,9-11H,2,5-8H2,1H3/b4-3+ |
| InChIKey | ZIKISRYAZWSZJC-ONEGZZNKSA-N |
| XLogP | 2.86 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.86 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 1-[(E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoyl]piperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-[(E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoyl]piperidine-4-carboxylate?
The IUPAC name of ethyl 1-[(E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoyl]piperidine-4-carboxylate (CID 6235647) is ethyl 1-[(E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoyl]piperidine-4-carboxylate.
What is the SMILES notation for ethyl 1-[(E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoyl]piperidine-4-carboxylate?
The canonical SMILES for ethyl 1-[(E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoyl]piperidine-4-carboxylate is CCOC(=O)C1CCN(C(=O)/C=C/c2c(Cl)nc3sccn23)CC1.
What is the InChIKey of ethyl 1-[(E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoyl]piperidine-4-carboxylate?
The InChIKey is ZIKISRYAZWSZJC-ONEGZZNKSA-N. The full InChI is InChI=1S/C16H18ClN3O3S/c1-2-23-15(22)11-5-7-19(8-6-11)13(21)4-3-12-14(17)18-16-20(12)9-10-24-16/h3-4,9-11H,2,5-8H2,1H3/b4-3+.
What are the key properties of ethyl 1-[(E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoyl]piperidine-4-carboxylate?
ethyl 1-[(E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoyl]piperidine-4-carboxylate has a molecular weight of 367.86 g/mol, XLogP of 2.86, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-[(E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoyl]piperidine-4-carboxylate is sourced from PubChem (CID 6235647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).