C15H30N2O2 — CID 62356650
N,N-diethyl-4-[3-(2-hydroxyethyl)piperidin-1-yl]butanamide (PubChem CID 62356650) has the molecular formula C15H30N2O2 and a molecular weight of 270.42 g/mol. Its IUPAC name is N,N-diethyl-4-[3-(2-hydroxyethyl)piperidin-1-yl]butanamide.
| Compound Name | N,N-diethyl-4-[3-(2-hydroxyethyl)piperidin-1-yl]butanamide |
|---|---|
| PubChem CID | 62356650 |
| Molecular Formula | C15H30N2O2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | N,N-diethyl-4-[3-(2-hydroxyethyl)piperidin-1-yl]butanamide |
| SMILES | CCN(CC)C(=O)CCCN1CCCC(CCO)C1 |
| InChI | InChI=1S/C15H30N2O2/c1-3-17(4-2)15(19)8-6-11-16-10-5-7-14(13-16)9-12-18/h14,18H,3-13H2,1-2H3 |
| InChIKey | LFOPPPFFNZUSSL-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |