C13H27N3 — CID 62357709
1-methyl-4-(2-piperidin-3-ylethyl)-1,4-diazepane (PubChem CID 62357709) has the molecular formula C13H27N3 and a molecular weight of 225.38 g/mol. Its IUPAC name is 1-methyl-4-(2-piperidin-3-ylethyl)-1,4-diazepane.
| Compound Name | 1-methyl-4-(2-piperidin-3-ylethyl)-1,4-diazepane |
|---|---|
| PubChem CID | 62357709 |
| Molecular Formula | C13H27N3 |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.22 |
| IUPAC Name | 1-methyl-4-(2-piperidin-3-ylethyl)-1,4-diazepane |
| SMILES | CN1CCCN(CCC2CCCNC2)CC1 |
| InChI | InChI=1S/C13H27N3/c1-15-7-3-8-16(11-10-15)9-5-13-4-2-6-14-12-13/h13-14H,2-12H2,1H3 |
| InChIKey | KYWJTCUABCJGMW-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |