C14H20ClNO3S — CID 62358135
2-[1-(4-chloro-2-methylphenyl)sulfonylpiperidin-3-yl]ethanol (PubChem CID 62358135) has the molecular formula C14H20ClNO3S and a molecular weight of 317.84 g/mol. Its IUPAC name is 2-[1-(4-chloro-2-methylphenyl)sulfonylpiperidin-3-yl]ethanol.
| Compound Name | 2-[1-(4-chloro-2-methylphenyl)sulfonylpiperidin-3-yl]ethanol |
|---|---|
| PubChem CID | 62358135 |
| Molecular Formula | C14H20ClNO3S |
| Molecular Weight | 317.84 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 2-[1-(4-chloro-2-methylphenyl)sulfonylpiperidin-3-yl]ethanol |
| SMILES | Cc1cc(Cl)ccc1S(=O)(=O)N1CCCC(CCO)C1 |
| InChI | InChI=1S/C14H20ClNO3S/c1-11-9-13(15)4-5-14(11)20(18,19)16-7-2-3-12(10-16)6-8-17/h4-5,9,12,17H,2-3,6-8,10H2,1H3 |
| InChIKey | STWMJLROCXHGMB-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.84 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |