C15H20BrFN2O2 — CID 62358331
N-(4-bromo-2-fluorophenyl)-2-[3-(2-hydroxyethyl)piperidin-1-yl]acetamide (PubChem CID 62358331) has the molecular formula C15H20BrFN2O2 and a molecular weight of 359.24 g/mol. Its IUPAC name is N-(4-bromo-2-fluorophenyl)-2-[3-(2-hydroxyethyl)piperidin-1-yl]acetamide.
| Compound Name | N-(4-bromo-2-fluorophenyl)-2-[3-(2-hydroxyethyl)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 62358331 |
| Molecular Formula | C15H20BrFN2O2 |
| Molecular Weight | 359.24 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | N-(4-bromo-2-fluorophenyl)-2-[3-(2-hydroxyethyl)piperidin-1-yl]acetamide |
| SMILES | O=C(CN1CCCC(CCO)C1)Nc1ccc(Br)cc1F |
| InChI | InChI=1S/C15H20BrFN2O2/c16-12-3-4-14(13(17)8-12)18-15(21)10-19-6-1-2-11(9-19)5-7-20/h3-4,8,11,20H,1-2,5-7,9-10H2,(H,18,21) |
| InChIKey | UIDGOTGZHOWMCJ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.24 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |