About 2-methyl-1-propyl-1-(2,2,2-trifluoroethyl)guanidine
2-methyl-1-propyl-1-(2,2,2-trifluoroethyl)guanidine (PubChem CID 62358422) has the molecular formula C7H14F3N3
and a molecular weight of 197.20 g/mol. Its IUPAC name is 2-methyl-1-propyl-1-(2,2,2-trifluoroethyl)guanidine.
Molecular Properties
| Compound Name | 2-methyl-1-propyl-1-(2,2,2-trifluoroethyl)guanidine |
| PubChem CID | 62358422 |
| Molecular Formula | C7H14F3N3 |
| Molecular Weight | 197.20 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | 2-methyl-1-propyl-1-(2,2,2-trifluoroethyl)guanidine |
| SMILES | CCCN(CC(F)(F)F)/C(N)=N/C |
| InChI | InChI=1S/C7H14F3N3/c1-3-4-13(6(11)12-2)5-7(8,9)10/h3-5H2,1-2H3,(H2,11,12) |
| InChIKey | KQIFIYWCBHLOOT-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.20 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-1-propyl-1-(2,2,2-trifluoroethyl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1-propyl-1-(2,2,2-trifluoroethyl)guanidine?
The IUPAC name of 2-methyl-1-propyl-1-(2,2,2-trifluoroethyl)guanidine (CID 62358422) is 2-methyl-1-propyl-1-(2,2,2-trifluoroethyl)guanidine.
What is the SMILES notation for 2-methyl-1-propyl-1-(2,2,2-trifluoroethyl)guanidine?
The canonical SMILES for 2-methyl-1-propyl-1-(2,2,2-trifluoroethyl)guanidine is CCCN(CC(F)(F)F)/C(N)=N/C.
What is the InChIKey of 2-methyl-1-propyl-1-(2,2,2-trifluoroethyl)guanidine?
The InChIKey is KQIFIYWCBHLOOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14F3N3/c1-3-4-13(6(11)12-2)5-7(8,9)10/h3-5H2,1-2H3,(H2,11,12).
What are the key properties of 2-methyl-1-propyl-1-(2,2,2-trifluoroethyl)guanidine?
2-methyl-1-propyl-1-(2,2,2-trifluoroethyl)guanidine has a molecular weight of 197.20 g/mol, XLogP of 1.21, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1-propyl-1-(2,2,2-trifluoroethyl)guanidine is sourced from PubChem (CID 62358422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).