C11H17N3 — CID 62358606
1-(4-ethylphenyl)-1,2-dimethylguanidine (PubChem CID 62358606) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-1,2-dimethylguanidine.
| Compound Name | 1-(4-ethylphenyl)-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 62358606 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | 1-(4-ethylphenyl)-1,2-dimethylguanidine |
| SMILES | CCc1ccc(N(C)/C(N)=N/C)cc1 |
| InChI | InChI=1S/C11H17N3/c1-4-9-5-7-10(8-6-9)14(3)11(12)13-2/h5-8H,4H2,1-3H3,(H2,12,13) |
| InChIKey | FZBHYPUCBYZHMM-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|