C18H20N2O2S — CID 6235868
N-[(E)-(5,7-dimethyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino]benzenesulfonamide (PubChem CID 6235868) has the molecular formula C18H20N2O2S and a molecular weight of 328.44 g/mol. Its IUPAC name is N-[(E)-(5,7-dimethyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino]benzenesulfonamide.
| Compound Name | N-[(E)-(5,7-dimethyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 6235868 |
| Molecular Formula | C18H20N2O2S |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | N-[(E)-(5,7-dimethyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino]benzenesulfonamide |
| SMILES | Cc1cc(C)c2c(c1)/C(=N/NS(=O)(=O)c1ccccc1)CCC2 |
| InChI | InChI=1S/C18H20N2O2S/c1-13-11-14(2)16-9-6-10-18(17(16)12-13)19-20-23(21,22)15-7-4-3-5-8-15/h3-5,7-8,11-12,20H,6,9-10H2,1-2H3/b19-18+ |
| InChIKey | NMIJDWGTSNPCJX-VHEBQXMUSA-N |
| XLogP | 3.32 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|