C24H28O3 — CID 623589
3,3,6,6-tetramethyl-9-(4-methylphenyl)-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione (PubChem CID 623589) has the molecular formula C24H28O3 and a molecular weight of 364.49 g/mol. Its IUPAC name is 3,3,6,6-tetramethyl-9-(4-methylphenyl)-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione.
| Compound Name | 3,3,6,6-tetramethyl-9-(4-methylphenyl)-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione |
|---|---|
| PubChem CID | 623589 |
| Molecular Formula | C24H28O3 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 3,3,6,6-tetramethyl-9-(4-methylphenyl)-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione |
| SMILES | Cc1ccc(C2C3=C(CC(C)(C)CC3=O)OC3=C2C(=O)CC(C)(C)C3)cc1 |
| InChI | InChI=1S/C24H28O3/c1-14-6-8-15(9-7-14)20-21-16(25)10-23(2,3)12-18(21)27-19-13-24(4,5)11-17(26)22(19)20/h6-9,20H,10-13H2,1-5H3 |
| InChIKey | DEHFHAGSCBXSGY-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |