About 1-cyclopropyl-1,2-diethylguanidine
1-cyclopropyl-1,2-diethylguanidine (PubChem CID 62359010) has the molecular formula C8H17N3
and a molecular weight of 155.25 g/mol. Its IUPAC name is 1-cyclopropyl-1,2-diethylguanidine.
Molecular Properties
| Compound Name | 1-cyclopropyl-1,2-diethylguanidine |
| PubChem CID | 62359010 |
| Molecular Formula | C8H17N3 |
| Molecular Weight | 155.25 g/mol |
| Exact Mass | 155.14 |
| IUPAC Name | 1-cyclopropyl-1,2-diethylguanidine |
| SMILES | CC/N=C(\N)N(CC)C1CC1 |
| InChI | InChI=1S/C8H17N3/c1-3-10-8(9)11(4-2)7-5-6-7/h7H,3-6H2,1-2H3,(H2,9,10) |
| InChIKey | BUUINQDSOCQYQM-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.25 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclopropyl-1,2-diethylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-1,2-diethylguanidine?
The IUPAC name of 1-cyclopropyl-1,2-diethylguanidine (CID 62359010) is 1-cyclopropyl-1,2-diethylguanidine.
What is the SMILES notation for 1-cyclopropyl-1,2-diethylguanidine?
The canonical SMILES for 1-cyclopropyl-1,2-diethylguanidine is CC/N=C(\N)N(CC)C1CC1.
What is the InChIKey of 1-cyclopropyl-1,2-diethylguanidine?
The InChIKey is BUUINQDSOCQYQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N3/c1-3-10-8(9)11(4-2)7-5-6-7/h7H,3-6H2,1-2H3,(H2,9,10).
What are the key properties of 1-cyclopropyl-1,2-diethylguanidine?
1-cyclopropyl-1,2-diethylguanidine has a molecular weight of 155.25 g/mol, XLogP of 0.81, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-1,2-diethylguanidine is sourced from PubChem (CID 62359010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).