About 1-(1,1-dioxothian-4-yl)-2-methylguanidine
1-(1,1-dioxothian-4-yl)-2-methylguanidine (PubChem CID 62359343) has the molecular formula C7H15N3O2S
and a molecular weight of 205.28 g/mol. Its IUPAC name is 1-(1,1-dioxothian-4-yl)-2-methylguanidine.
Molecular Properties
| Compound Name | 1-(1,1-dioxothian-4-yl)-2-methylguanidine |
| PubChem CID | 62359343 |
| Molecular Formula | C7H15N3O2S |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 1-(1,1-dioxothian-4-yl)-2-methylguanidine |
| SMILES | C/N=C(\N)NC1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C7H15N3O2S/c1-9-7(8)10-6-2-4-13(11,12)5-3-6/h6H,2-5H2,1H3,(H3,8,9,10) |
| InChIKey | FVCVWJUFCNSIDP-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,1-dioxothian-4-yl)-2-methylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,1-dioxothian-4-yl)-2-methylguanidine?
The IUPAC name of 1-(1,1-dioxothian-4-yl)-2-methylguanidine (CID 62359343) is 1-(1,1-dioxothian-4-yl)-2-methylguanidine.
What is the SMILES notation for 1-(1,1-dioxothian-4-yl)-2-methylguanidine?
The canonical SMILES for 1-(1,1-dioxothian-4-yl)-2-methylguanidine is C/N=C(\N)NC1CCS(=O)(=O)CC1.
What is the InChIKey of 1-(1,1-dioxothian-4-yl)-2-methylguanidine?
The InChIKey is FVCVWJUFCNSIDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N3O2S/c1-9-7(8)10-6-2-4-13(11,12)5-3-6/h6H,2-5H2,1H3,(H3,8,9,10).
What are the key properties of 1-(1,1-dioxothian-4-yl)-2-methylguanidine?
1-(1,1-dioxothian-4-yl)-2-methylguanidine has a molecular weight of 205.28 g/mol, XLogP of -0.90, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,1-dioxothian-4-yl)-2-methylguanidine is sourced from PubChem (CID 62359343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).