About 2-cyclopropyl-1,1-dipropylguanidine
2-cyclopropyl-1,1-dipropylguanidine (PubChem CID 62359563) has the molecular formula C10H21N3
and a molecular weight of 183.30 g/mol. Its IUPAC name is 2-cyclopropyl-1,1-dipropylguanidine.
Molecular Properties
| Compound Name | 2-cyclopropyl-1,1-dipropylguanidine |
| PubChem CID | 62359563 |
| Molecular Formula | C10H21N3 |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.17 |
| IUPAC Name | 2-cyclopropyl-1,1-dipropylguanidine |
| SMILES | CCCN(CCC)/C(N)=N/C1CC1 |
| InChI | InChI=1S/C10H21N3/c1-3-7-13(8-4-2)10(11)12-9-5-6-9/h9H,3-8H2,1-2H3,(H2,11,12) |
| InChIKey | BWNMHGOOLOGMHH-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclopropyl-1,1-dipropylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-1,1-dipropylguanidine?
The IUPAC name of 2-cyclopropyl-1,1-dipropylguanidine (CID 62359563) is 2-cyclopropyl-1,1-dipropylguanidine.
What is the SMILES notation for 2-cyclopropyl-1,1-dipropylguanidine?
The canonical SMILES for 2-cyclopropyl-1,1-dipropylguanidine is CCCN(CCC)/C(N)=N/C1CC1.
What is the InChIKey of 2-cyclopropyl-1,1-dipropylguanidine?
The InChIKey is BWNMHGOOLOGMHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N3/c1-3-7-13(8-4-2)10(11)12-9-5-6-9/h9H,3-8H2,1-2H3,(H2,11,12).
What are the key properties of 2-cyclopropyl-1,1-dipropylguanidine?
2-cyclopropyl-1,1-dipropylguanidine has a molecular weight of 183.30 g/mol, XLogP of 1.59, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-1,1-dipropylguanidine is sourced from PubChem (CID 62359563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).