C6H15N3O — CID 62359692
1-(2-methoxyethyl)-1,2-dimethylguanidine (PubChem CID 62359692) has the molecular formula C6H15N3O and a molecular weight of 145.21 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-1,2-dimethylguanidine.
| Compound Name | 1-(2-methoxyethyl)-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 62359692 |
| Molecular Formula | C6H15N3O |
| Molecular Weight | 145.21 g/mol |
| Exact Mass | 145.12 |
| IUPAC Name | 1-(2-methoxyethyl)-1,2-dimethylguanidine |
| SMILES | C/N=C(\N)N(C)CCOC |
| InChI | InChI=1S/C6H15N3O/c1-8-6(7)9(2)4-5-10-3/h4-5H2,1-3H3,(H2,7,8) |
| InChIKey | ZHIUBGDJRIJRNW-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.21 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|