C7H16N4O — CID 62360115
N-ethyl-2-[(N'-methylcarbamimidoyl)amino]propanamide (PubChem CID 62360115) has the molecular formula C7H16N4O and a molecular weight of 172.23 g/mol. Its IUPAC name is N-ethyl-2-[(N'-methylcarbamimidoyl)amino]propanamide.
| Compound Name | N-ethyl-2-[(N'-methylcarbamimidoyl)amino]propanamide |
|---|---|
| PubChem CID | 62360115 |
| Molecular Formula | C7H16N4O |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | N-ethyl-2-[(N'-methylcarbamimidoyl)amino]propanamide |
| SMILES | CCNC(=O)C(C)N/C(N)=N/C |
| InChI | InChI=1S/C7H16N4O/c1-4-10-6(12)5(2)11-7(8)9-3/h5H,4H2,1-3H3,(H,10,12)(H3,8,9,11) |
| InChIKey | DIPJWZOTSVOUFT-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|