4-bromo-2-quinoxalin-2-yloxybenzoic acid

C15H9BrN2O3 — CID 62360418

IUPAC4-bromo-2-quinoxalin-2-yloxybenzoic acid
SMILESO=C(O)c1ccc(Br)cc1Oc1cnc2ccccc2n1
InChIInChI=1S/C15H9BrN2O3/c16-9-5-6-10(15(19)20)13(7-9)21-14-8-17-11-3-1-2-4-12(11)18-14/h1-8H,(H,19,20)
InChIKeyAXCIDRQCLBWYHI-UHFFFAOYSA-N
MW345.15 g/mol
LogP3.88
Rot. Bonds3

About 4-bromo-2-quinoxalin-2-yloxybenzoic acid

4-bromo-2-quinoxalin-2-yloxybenzoic acid (PubChem CID 62360418) has the molecular formula C15H9BrN2O3 and a molecular weight of 345.15 g/mol. Its IUPAC name is 4-bromo-2-quinoxalin-2-yloxybenzoic acid.

Molecular Properties

Compound Name4-bromo-2-quinoxalin-2-yloxybenzoic acid
PubChem CID62360418
Molecular FormulaC15H9BrN2O3
Molecular Weight345.15 g/mol
Exact Mass343.98
IUPAC Name4-bromo-2-quinoxalin-2-yloxybenzoic acid
SMILESO=C(O)c1ccc(Br)cc1Oc1cnc2ccccc2n1
InChIInChI=1S/C15H9BrN2O3/c16-9-5-6-10(15(19)20)13(7-9)21-14-8-17-11-3-1-2-4-12(11)18-14/h1-8H,(H,19,20)
InChIKeyAXCIDRQCLBWYHI-UHFFFAOYSA-N
XLogP3.88
TPSA72.31 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500345.15
LogP ≤ 53.88
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 4-bromo-2-quinoxalin-2-yloxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-bromo-2-quinoxalin-2-yloxybenzoic acid?
The IUPAC name of 4-bromo-2-quinoxalin-2-yloxybenzoic acid (CID 62360418) is 4-bromo-2-quinoxalin-2-yloxybenzoic acid.
What is the SMILES notation for 4-bromo-2-quinoxalin-2-yloxybenzoic acid?
The canonical SMILES for 4-bromo-2-quinoxalin-2-yloxybenzoic acid is O=C(O)c1ccc(Br)cc1Oc1cnc2ccccc2n1.
What is the InChIKey of 4-bromo-2-quinoxalin-2-yloxybenzoic acid?
The InChIKey is AXCIDRQCLBWYHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9BrN2O3/c16-9-5-6-10(15(19)20)13(7-9)21-14-8-17-11-3-1-2-4-12(11)18-14/h1-8H,(H,19,20).
What are the key properties of 4-bromo-2-quinoxalin-2-yloxybenzoic acid?
4-bromo-2-quinoxalin-2-yloxybenzoic acid has a molecular weight of 345.15 g/mol, XLogP of 3.88, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2-quinoxalin-2-yloxybenzoic acid is sourced from PubChem (CID 62360418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).