C8H17N3 — CID 62360610
1-(1-cyclopropylethyl)-1,2-dimethylguanidine (PubChem CID 62360610) has the molecular formula C8H17N3 and a molecular weight of 155.24 g/mol. Its IUPAC name is 1-(1-cyclopropylethyl)-1,2-dimethylguanidine.
| Compound Name | 1-(1-cyclopropylethyl)-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 62360610 |
| Molecular Formula | C8H17N3 |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.14 |
| IUPAC Name | 1-(1-cyclopropylethyl)-1,2-dimethylguanidine |
| SMILES | C/N=C(\N)N(C)C(C)C1CC1 |
| InChI | InChI=1S/C8H17N3/c1-6(7-4-5-7)11(3)8(9)10-2/h6-7H,4-5H2,1-3H3,(H2,9,10) |
| InChIKey | DSAHNQRKJMJVNQ-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|