About N-(2-hydroxycyclohexyl)-2,3-dihydro-1,4-dioxine-5-carboxamide
N-(2-hydroxycyclohexyl)-2,3-dihydro-1,4-dioxine-5-carboxamide (PubChem CID 62360697) has the molecular formula C11H17NO4
and a molecular weight of 227.26 g/mol. Its IUPAC name is N-(2-hydroxycyclohexyl)-2,3-dihydro-1,4-dioxine-5-carboxamide.
Molecular Properties
| Compound Name | N-(2-hydroxycyclohexyl)-2,3-dihydro-1,4-dioxine-5-carboxamide |
| PubChem CID | 62360697 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | N-(2-hydroxycyclohexyl)-2,3-dihydro-1,4-dioxine-5-carboxamide |
| SMILES | O=C(NC1CCCCC1O)C1=COCCO1 |
| InChI | InChI=1S/C11H17NO4/c13-9-4-2-1-3-8(9)12-11(14)10-7-15-5-6-16-10/h7-9,13H,1-6H2,(H,12,14) |
| InChIKey | QIZWXNRJJHEPAN-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(2-hydroxycyclohexyl)-2,3-dihydro-1,4-dioxine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-hydroxycyclohexyl)-2,3-dihydro-1,4-dioxine-5-carboxamide?
The IUPAC name of N-(2-hydroxycyclohexyl)-2,3-dihydro-1,4-dioxine-5-carboxamide (CID 62360697) is N-(2-hydroxycyclohexyl)-2,3-dihydro-1,4-dioxine-5-carboxamide.
What is the SMILES notation for N-(2-hydroxycyclohexyl)-2,3-dihydro-1,4-dioxine-5-carboxamide?
The canonical SMILES for N-(2-hydroxycyclohexyl)-2,3-dihydro-1,4-dioxine-5-carboxamide is O=C(NC1CCCCC1O)C1=COCCO1.
What is the InChIKey of N-(2-hydroxycyclohexyl)-2,3-dihydro-1,4-dioxine-5-carboxamide?
The InChIKey is QIZWXNRJJHEPAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO4/c13-9-4-2-1-3-8(9)12-11(14)10-7-15-5-6-16-10/h7-9,13H,1-6H2,(H,12,14).
What are the key properties of N-(2-hydroxycyclohexyl)-2,3-dihydro-1,4-dioxine-5-carboxamide?
N-(2-hydroxycyclohexyl)-2,3-dihydro-1,4-dioxine-5-carboxamide has a molecular weight of 227.26 g/mol, XLogP of 0.29, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-hydroxycyclohexyl)-2,3-dihydro-1,4-dioxine-5-carboxamide is sourced from PubChem (CID 62360697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).