C14H22N2O3S — CID 62360873
3-[1-[(2-hydroxycyclohexyl)amino]ethyl]benzenesulfonamide (PubChem CID 62360873) has the molecular formula C14H22N2O3S and a molecular weight of 298.41 g/mol. Its IUPAC name is 3-[1-[(2-hydroxycyclohexyl)amino]ethyl]benzenesulfonamide.
| Compound Name | 3-[1-[(2-hydroxycyclohexyl)amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 62360873 |
| Molecular Formula | C14H22N2O3S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 3-[1-[(2-hydroxycyclohexyl)amino]ethyl]benzenesulfonamide |
| SMILES | CC(NC1CCCCC1O)c1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C14H22N2O3S/c1-10(16-13-7-2-3-8-14(13)17)11-5-4-6-12(9-11)20(15,18)19/h4-6,9-10,13-14,16-17H,2-3,7-8H2,1H3,(H2,15,18,19) |
| InChIKey | SIGQPZUVFUYZEA-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |