C10F16 — CID 623611
1,1,2,2,3,3,4,4,5,5,6,7,7-tridecafluoro-6-(trifluoromethyl)indene (PubChem CID 623611) has the molecular formula C10F16 and a molecular weight of 424.08 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,7,7-tridecafluoro-6-(trifluoromethyl)indene.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,7,7-tridecafluoro-6-(trifluoromethyl)indene |
|---|---|
| PubChem CID | 623611 |
| Molecular Formula | C10F16 |
| Molecular Weight | 424.08 g/mol |
| Exact Mass | 423.97 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,7,7-tridecafluoro-6-(trifluoromethyl)indene |
| SMILES | FC(F)(F)C1(F)C(F)(F)C2=C(C(F)(F)C(F)(F)C2(F)F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C10F16/c11-3(12)1-2(5(15,16)8(20,21)4(1,13)14)6(17,18)9(22,23)7(3,19)10(24,25)26 |
| InChIKey | YJJFYFAWGMMWTK-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.08 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|