About 1-tert-butyl-2-(1,1-dioxothiolan-3-yl)guanidine
1-tert-butyl-2-(1,1-dioxothiolan-3-yl)guanidine (PubChem CID 62361731) has the molecular formula C9H19N3O2S
and a molecular weight of 233.34 g/mol. Its IUPAC name is 1-tert-butyl-2-(1,1-dioxothiolan-3-yl)guanidine.
Molecular Properties
| Compound Name | 1-tert-butyl-2-(1,1-dioxothiolan-3-yl)guanidine |
| PubChem CID | 62361731 |
| Molecular Formula | C9H19N3O2S |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 1-tert-butyl-2-(1,1-dioxothiolan-3-yl)guanidine |
| SMILES | CC(C)(C)N/C(N)=N/C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H19N3O2S/c1-9(2,3)12-8(10)11-7-4-5-15(13,14)6-7/h7H,4-6H2,1-3H3,(H3,10,11,12) |
| InChIKey | FHTUQWWBVBLNKE-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-tert-butyl-2-(1,1-dioxothiolan-3-yl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-2-(1,1-dioxothiolan-3-yl)guanidine?
The IUPAC name of 1-tert-butyl-2-(1,1-dioxothiolan-3-yl)guanidine (CID 62361731) is 1-tert-butyl-2-(1,1-dioxothiolan-3-yl)guanidine.
What is the SMILES notation for 1-tert-butyl-2-(1,1-dioxothiolan-3-yl)guanidine?
The canonical SMILES for 1-tert-butyl-2-(1,1-dioxothiolan-3-yl)guanidine is CC(C)(C)N/C(N)=N/C1CCS(=O)(=O)C1.
What is the InChIKey of 1-tert-butyl-2-(1,1-dioxothiolan-3-yl)guanidine?
The InChIKey is FHTUQWWBVBLNKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N3O2S/c1-9(2,3)12-8(10)11-7-4-5-15(13,14)6-7/h7H,4-6H2,1-3H3,(H3,10,11,12).
What are the key properties of 1-tert-butyl-2-(1,1-dioxothiolan-3-yl)guanidine?
1-tert-butyl-2-(1,1-dioxothiolan-3-yl)guanidine has a molecular weight of 233.34 g/mol, XLogP of -0.12, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-2-(1,1-dioxothiolan-3-yl)guanidine is sourced from PubChem (CID 62361731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).