About 2-cyclohexyl-1,1-bis(2-methoxyethyl)guanidine
2-cyclohexyl-1,1-bis(2-methoxyethyl)guanidine (PubChem CID 62361851) has the molecular formula C13H27N3O2
and a molecular weight of 257.38 g/mol. Its IUPAC name is 2-cyclohexyl-1,1-bis(2-methoxyethyl)guanidine.
Molecular Properties
| Compound Name | 2-cyclohexyl-1,1-bis(2-methoxyethyl)guanidine |
| PubChem CID | 62361851 |
| Molecular Formula | C13H27N3O2 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | 2-cyclohexyl-1,1-bis(2-methoxyethyl)guanidine |
| SMILES | COCCN(CCOC)/C(N)=N/C1CCCCC1 |
| InChI | InChI=1S/C13H27N3O2/c1-17-10-8-16(9-11-18-2)13(14)15-12-6-4-3-5-7-12/h12H,3-11H2,1-2H3,(H2,14,15) |
| InChIKey | OAMHRODRVOMUGO-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohexyl-1,1-bis(2-methoxyethyl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-1,1-bis(2-methoxyethyl)guanidine?
The IUPAC name of 2-cyclohexyl-1,1-bis(2-methoxyethyl)guanidine (CID 62361851) is 2-cyclohexyl-1,1-bis(2-methoxyethyl)guanidine.
What is the SMILES notation for 2-cyclohexyl-1,1-bis(2-methoxyethyl)guanidine?
The canonical SMILES for 2-cyclohexyl-1,1-bis(2-methoxyethyl)guanidine is COCCN(CCOC)/C(N)=N/C1CCCCC1.
What is the InChIKey of 2-cyclohexyl-1,1-bis(2-methoxyethyl)guanidine?
The InChIKey is OAMHRODRVOMUGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27N3O2/c1-17-10-8-16(9-11-18-2)13(14)15-12-6-4-3-5-7-12/h12H,3-11H2,1-2H3,(H2,14,15).
What are the key properties of 2-cyclohexyl-1,1-bis(2-methoxyethyl)guanidine?
2-cyclohexyl-1,1-bis(2-methoxyethyl)guanidine has a molecular weight of 257.38 g/mol, XLogP of 1.23, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-1,1-bis(2-methoxyethyl)guanidine is sourced from PubChem (CID 62361851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).