C13H19N3 — CID 62361894
2-cyclopropyl-1-ethyl-1-(3-methylphenyl)guanidine (PubChem CID 62361894) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is 2-cyclopropyl-1-ethyl-1-(3-methylphenyl)guanidine.
| Compound Name | 2-cyclopropyl-1-ethyl-1-(3-methylphenyl)guanidine |
|---|---|
| PubChem CID | 62361894 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 2-cyclopropyl-1-ethyl-1-(3-methylphenyl)guanidine |
| SMILES | CCN(/C(N)=N/C1CC1)c1cccc(C)c1 |
| InChI | InChI=1S/C13H19N3/c1-3-16(13(14)15-11-7-8-11)12-6-4-5-10(2)9-12/h4-6,9,11H,3,7-8H2,1-2H3,(H2,14,15) |
| InChIKey | GAHJDUDYTFPFIY-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|