About 2-cyclohexyl-1,1-bis(2-methylpropyl)guanidine
2-cyclohexyl-1,1-bis(2-methylpropyl)guanidine (PubChem CID 62362061) has the molecular formula C15H31N3
and a molecular weight of 253.43 g/mol. Its IUPAC name is 2-cyclohexyl-1,1-bis(2-methylpropyl)guanidine.
Molecular Properties
| Compound Name | 2-cyclohexyl-1,1-bis(2-methylpropyl)guanidine |
| PubChem CID | 62362061 |
| Molecular Formula | C15H31N3 |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.25 |
| IUPAC Name | 2-cyclohexyl-1,1-bis(2-methylpropyl)guanidine |
| SMILES | CC(C)CN(CC(C)C)/C(N)=N/C1CCCCC1 |
| InChI | InChI=1S/C15H31N3/c1-12(2)10-18(11-13(3)4)15(16)17-14-8-6-5-7-9-14/h12-14H,5-11H2,1-4H3,(H2,16,17) |
| InChIKey | BDVKZJKLWZHDFJ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohexyl-1,1-bis(2-methylpropyl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-1,1-bis(2-methylpropyl)guanidine?
The IUPAC name of 2-cyclohexyl-1,1-bis(2-methylpropyl)guanidine (CID 62362061) is 2-cyclohexyl-1,1-bis(2-methylpropyl)guanidine.
What is the SMILES notation for 2-cyclohexyl-1,1-bis(2-methylpropyl)guanidine?
The canonical SMILES for 2-cyclohexyl-1,1-bis(2-methylpropyl)guanidine is CC(C)CN(CC(C)C)/C(N)=N/C1CCCCC1.
What is the InChIKey of 2-cyclohexyl-1,1-bis(2-methylpropyl)guanidine?
The InChIKey is BDVKZJKLWZHDFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31N3/c1-12(2)10-18(11-13(3)4)15(16)17-14-8-6-5-7-9-14/h12-14H,5-11H2,1-4H3,(H2,16,17).
What are the key properties of 2-cyclohexyl-1,1-bis(2-methylpropyl)guanidine?
2-cyclohexyl-1,1-bis(2-methylpropyl)guanidine has a molecular weight of 253.43 g/mol, XLogP of 3.25, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-1,1-bis(2-methylpropyl)guanidine is sourced from PubChem (CID 62362061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).