About 1,2-dicyclopropylguanidine
1,2-dicyclopropylguanidine (PubChem CID 62362831) has the molecular formula C7H13N3
and a molecular weight of 139.20 g/mol. Its IUPAC name is 1,2-dicyclopropylguanidine.
Molecular Properties
| Compound Name | 1,2-dicyclopropylguanidine |
| PubChem CID | 62362831 |
| Molecular Formula | C7H13N3 |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.11 |
| IUPAC Name | 1,2-dicyclopropylguanidine |
| SMILES | N/C(=N\C1CC1)NC1CC1 |
| InChI | InChI=1S/C7H13N3/c8-7(9-5-1-2-5)10-6-3-4-6/h5-6H,1-4H2,(H3,8,9,10) |
| InChIKey | VPEMEDDYEDWEHY-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dicyclopropylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dicyclopropylguanidine?
The IUPAC name of 1,2-dicyclopropylguanidine (CID 62362831) is 1,2-dicyclopropylguanidine.
What is the SMILES notation for 1,2-dicyclopropylguanidine?
The canonical SMILES for 1,2-dicyclopropylguanidine is N/C(=N\C1CC1)NC1CC1.
What is the InChIKey of 1,2-dicyclopropylguanidine?
The InChIKey is VPEMEDDYEDWEHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3/c8-7(9-5-1-2-5)10-6-3-4-6/h5-6H,1-4H2,(H3,8,9,10).
What are the key properties of 1,2-dicyclopropylguanidine?
1,2-dicyclopropylguanidine has a molecular weight of 139.20 g/mol, XLogP of 0.22, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dicyclopropylguanidine is sourced from PubChem (CID 62362831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).