About 1-propan-2-yl-2-(1,3-thiazol-2-ylmethyl)guanidine
1-propan-2-yl-2-(1,3-thiazol-2-ylmethyl)guanidine (PubChem CID 62363334) has the molecular formula C8H14N4S
and a molecular weight of 198.29 g/mol. Its IUPAC name is 1-propan-2-yl-2-(1,3-thiazol-2-ylmethyl)guanidine.
Molecular Properties
| Compound Name | 1-propan-2-yl-2-(1,3-thiazol-2-ylmethyl)guanidine |
| PubChem CID | 62363334 |
| Molecular Formula | C8H14N4S |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 1-propan-2-yl-2-(1,3-thiazol-2-ylmethyl)guanidine |
| SMILES | CC(C)N/C(N)=N/Cc1nccs1 |
| InChI | InChI=1S/C8H14N4S/c1-6(2)12-8(9)11-5-7-10-3-4-13-7/h3-4,6H,5H2,1-2H3,(H3,9,11,12) |
| InChIKey | UKFQIMXDUPZFAN-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-propan-2-yl-2-(1,3-thiazol-2-ylmethyl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propan-2-yl-2-(1,3-thiazol-2-ylmethyl)guanidine?
The IUPAC name of 1-propan-2-yl-2-(1,3-thiazol-2-ylmethyl)guanidine (CID 62363334) is 1-propan-2-yl-2-(1,3-thiazol-2-ylmethyl)guanidine.
What is the SMILES notation for 1-propan-2-yl-2-(1,3-thiazol-2-ylmethyl)guanidine?
The canonical SMILES for 1-propan-2-yl-2-(1,3-thiazol-2-ylmethyl)guanidine is CC(C)N/C(N)=N/Cc1nccs1.
What is the InChIKey of 1-propan-2-yl-2-(1,3-thiazol-2-ylmethyl)guanidine?
The InChIKey is UKFQIMXDUPZFAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4S/c1-6(2)12-8(9)11-5-7-10-3-4-13-7/h3-4,6H,5H2,1-2H3,(H3,9,11,12).
What are the key properties of 1-propan-2-yl-2-(1,3-thiazol-2-ylmethyl)guanidine?
1-propan-2-yl-2-(1,3-thiazol-2-ylmethyl)guanidine has a molecular weight of 198.29 g/mol, XLogP of 0.96, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propan-2-yl-2-(1,3-thiazol-2-ylmethyl)guanidine is sourced from PubChem (CID 62363334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).