C9H20N4 — CID 62363794
1-(1-methylpyrrolidin-3-yl)-2-propylguanidine (PubChem CID 62363794) has the molecular formula C9H20N4 and a molecular weight of 184.29 g/mol. Its IUPAC name is 1-(1-methylpyrrolidin-3-yl)-2-propylguanidine.
| Compound Name | 1-(1-methylpyrrolidin-3-yl)-2-propylguanidine |
|---|---|
| PubChem CID | 62363794 |
| Molecular Formula | C9H20N4 |
| Molecular Weight | 184.29 g/mol |
| Exact Mass | 184.17 |
| IUPAC Name | 1-(1-methylpyrrolidin-3-yl)-2-propylguanidine |
| SMILES | CCC/N=C(\N)NC1CCN(C)C1 |
| InChI | InChI=1S/C9H20N4/c1-3-5-11-9(10)12-8-4-6-13(2)7-8/h8H,3-7H2,1-2H3,(H3,10,11,12) |
| InChIKey | IYALQAFXGVWPCI-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.29 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|