C11H15N3 — CID 62364047
2-(cyclopropylmethyl)-1-phenylguanidine (PubChem CID 62364047) has the molecular formula C11H15N3 and a molecular weight of 189.26 g/mol. Its IUPAC name is 2-(cyclopropylmethyl)-1-phenylguanidine.
| Compound Name | 2-(cyclopropylmethyl)-1-phenylguanidine |
|---|---|
| PubChem CID | 62364047 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 2-(cyclopropylmethyl)-1-phenylguanidine |
| SMILES | N/C(=N\CC1CC1)Nc1ccccc1 |
| InChI | InChI=1S/C11H15N3/c12-11(13-8-9-6-7-9)14-10-4-2-1-3-5-10/h1-5,9H,6-8H2,(H3,12,13,14) |
| InChIKey | PMXFAPINGAHZRE-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|