C24H16Cl3NO3 — CID 6236425
(4E)-5-(4-chlorophenyl)-4-[(4-chlorophenyl)-hydroxymethylidene]-1-[(4-chlorophenyl)methyl]pyrrolidine-2,3-dione (PubChem CID 6236425) has the molecular formula C24H16Cl3NO3 and a molecular weight of 472.76 g/mol. Its IUPAC name is (4E)-5-(4-chlorophenyl)-4-[(4-chlorophenyl)-hydroxymethylidene]-1-[(4-chlorophenyl)methyl]pyrrolidine-2,3-dione.
| Compound Name | (4E)-5-(4-chlorophenyl)-4-[(4-chlorophenyl)-hydroxymethylidene]-1-[(4-chlorophenyl)methyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6236425 |
| Molecular Formula | C24H16Cl3NO3 |
| Molecular Weight | 472.76 g/mol |
| Exact Mass | 471.02 |
| IUPAC Name | (4E)-5-(4-chlorophenyl)-4-[(4-chlorophenyl)-hydroxymethylidene]-1-[(4-chlorophenyl)methyl]pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(Cc2ccc(Cl)cc2)C(c2ccc(Cl)cc2)/C1=C(\O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H16Cl3NO3/c25-17-7-1-14(2-8-17)13-28-21(15-3-9-18(26)10-4-15)20(23(30)24(28)31)22(29)16-5-11-19(27)12-6-16/h1-12,21,29H,13H2/b22-20+ |
| InChIKey | DVCIIHDFJJSFRN-LSDHQDQOSA-N |
| XLogP | 6.27 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.76 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|