About 2,2-dimethyl-N'-propan-2-ylmorpholine-4-carboximidamide
2,2-dimethyl-N'-propan-2-ylmorpholine-4-carboximidamide (PubChem CID 62364307) has the molecular formula C10H21N3O
and a molecular weight of 199.30 g/mol. Its IUPAC name is 2,2-dimethyl-N'-propan-2-ylmorpholine-4-carboximidamide.
Molecular Properties
| Compound Name | 2,2-dimethyl-N'-propan-2-ylmorpholine-4-carboximidamide |
| PubChem CID | 62364307 |
| Molecular Formula | C10H21N3O |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.17 |
| IUPAC Name | 2,2-dimethyl-N'-propan-2-ylmorpholine-4-carboximidamide |
| SMILES | CC(C)/N=C(\N)N1CCOC(C)(C)C1 |
| InChI | InChI=1S/C10H21N3O/c1-8(2)12-9(11)13-5-6-14-10(3,4)7-13/h8H,5-7H2,1-4H3,(H2,11,12) |
| InChIKey | AQPJUVHZUZOSBD-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethyl-N'-propan-2-ylmorpholine-4-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-N'-propan-2-ylmorpholine-4-carboximidamide?
The IUPAC name of 2,2-dimethyl-N'-propan-2-ylmorpholine-4-carboximidamide (CID 62364307) is 2,2-dimethyl-N'-propan-2-ylmorpholine-4-carboximidamide.
What is the SMILES notation for 2,2-dimethyl-N'-propan-2-ylmorpholine-4-carboximidamide?
The canonical SMILES for 2,2-dimethyl-N'-propan-2-ylmorpholine-4-carboximidamide is CC(C)/N=C(\N)N1CCOC(C)(C)C1.
What is the InChIKey of 2,2-dimethyl-N'-propan-2-ylmorpholine-4-carboximidamide?
The InChIKey is AQPJUVHZUZOSBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N3O/c1-8(2)12-9(11)13-5-6-14-10(3,4)7-13/h8H,5-7H2,1-4H3,(H2,11,12).
What are the key properties of 2,2-dimethyl-N'-propan-2-ylmorpholine-4-carboximidamide?
2,2-dimethyl-N'-propan-2-ylmorpholine-4-carboximidamide has a molecular weight of 199.30 g/mol, XLogP of 0.82, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-N'-propan-2-ylmorpholine-4-carboximidamide is sourced from PubChem (CID 62364307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).