C9H18F3N3 — CID 62364797
1,2-di(propan-2-yl)-1-(2,2,2-trifluoroethyl)guanidine (PubChem CID 62364797) has the molecular formula C9H18F3N3 and a molecular weight of 225.26 g/mol. Its IUPAC name is 1,2-di(propan-2-yl)-1-(2,2,2-trifluoroethyl)guanidine.
| Compound Name | 1,2-di(propan-2-yl)-1-(2,2,2-trifluoroethyl)guanidine |
|---|---|
| PubChem CID | 62364797 |
| Molecular Formula | C9H18F3N3 |
| Molecular Weight | 225.26 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 1,2-di(propan-2-yl)-1-(2,2,2-trifluoroethyl)guanidine |
| SMILES | CC(C)/N=C(\N)N(CC(F)(F)F)C(C)C |
| InChI | InChI=1S/C9H18F3N3/c1-6(2)14-8(13)15(7(3)4)5-9(10,11)12/h6-7H,5H2,1-4H3,(H2,13,14) |
| InChIKey | BXPRFPCGFDHWPX-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.26 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|