About 3-[[amino(ethylamino)methylidene]amino]-N,N-diethylpropanamide
3-[[amino(ethylamino)methylidene]amino]-N,N-diethylpropanamide (PubChem CID 62364812) has the molecular formula C10H22N4O
and a molecular weight of 214.31 g/mol. Its IUPAC name is 3-[[amino(ethylamino)methylidene]amino]-N,N-diethylpropanamide.
Molecular Properties
| Compound Name | 3-[[amino(ethylamino)methylidene]amino]-N,N-diethylpropanamide |
| PubChem CID | 62364812 |
| Molecular Formula | C10H22N4O |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.18 |
| IUPAC Name | 3-[[amino(ethylamino)methylidene]amino]-N,N-diethylpropanamide |
| SMILES | CCN/C(N)=N/CCC(=O)N(CC)CC |
| InChI | InChI=1S/C10H22N4O/c1-4-12-10(11)13-8-7-9(15)14(5-2)6-3/h4-8H2,1-3H3,(H3,11,12,13) |
| InChIKey | CQOWKHOMJGVCLW-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[[amino(ethylamino)methylidene]amino]-N,N-diethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[amino(ethylamino)methylidene]amino]-N,N-diethylpropanamide?
The IUPAC name of 3-[[amino(ethylamino)methylidene]amino]-N,N-diethylpropanamide (CID 62364812) is 3-[[amino(ethylamino)methylidene]amino]-N,N-diethylpropanamide.
What is the SMILES notation for 3-[[amino(ethylamino)methylidene]amino]-N,N-diethylpropanamide?
The canonical SMILES for 3-[[amino(ethylamino)methylidene]amino]-N,N-diethylpropanamide is CCN/C(N)=N/CCC(=O)N(CC)CC.
What is the InChIKey of 3-[[amino(ethylamino)methylidene]amino]-N,N-diethylpropanamide?
The InChIKey is CQOWKHOMJGVCLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N4O/c1-4-12-10(11)13-8-7-9(15)14(5-2)6-3/h4-8H2,1-3H3,(H3,11,12,13).
What are the key properties of 3-[[amino(ethylamino)methylidene]amino]-N,N-diethylpropanamide?
3-[[amino(ethylamino)methylidene]amino]-N,N-diethylpropanamide has a molecular weight of 214.31 g/mol, XLogP of 0.17, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[amino(ethylamino)methylidene]amino]-N,N-diethylpropanamide is sourced from PubChem (CID 62364812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).