C13H16N2O — CID 62365708
4-methyl-3-[2-(3-methylphenyl)ethyl]-1,2-oxazol-5-amine (PubChem CID 62365708) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 4-methyl-3-[2-(3-methylphenyl)ethyl]-1,2-oxazol-5-amine.
| Compound Name | 4-methyl-3-[2-(3-methylphenyl)ethyl]-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 62365708 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 4-methyl-3-[2-(3-methylphenyl)ethyl]-1,2-oxazol-5-amine |
| SMILES | Cc1cccc(CCc2noc(N)c2C)c1 |
| InChI | InChI=1S/C13H16N2O/c1-9-4-3-5-11(8-9)6-7-12-10(2)13(14)16-15-12/h3-5,8H,6-7,14H2,1-2H3 |
| InChIKey | VIQUBHNGINFIIQ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |