C14H26N4 — CID 62367966
3-(4-cyclopentylpiperazin-1-yl)-2-(ethylamino)propanenitrile (PubChem CID 62367966) has the molecular formula C14H26N4 and a molecular weight of 250.39 g/mol. Its IUPAC name is 3-(4-cyclopentylpiperazin-1-yl)-2-(ethylamino)propanenitrile.
| Compound Name | 3-(4-cyclopentylpiperazin-1-yl)-2-(ethylamino)propanenitrile |
|---|---|
| PubChem CID | 62367966 |
| Molecular Formula | C14H26N4 |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.22 |
| IUPAC Name | 3-(4-cyclopentylpiperazin-1-yl)-2-(ethylamino)propanenitrile |
| SMILES | CCNC(C#N)CN1CCN(C2CCCC2)CC1 |
| InChI | InChI=1S/C14H26N4/c1-2-16-13(11-15)12-17-7-9-18(10-8-17)14-5-3-4-6-14/h13-14,16H,2-10,12H2,1H3 |
| InChIKey | OLWUTZOQXJZTDU-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 42.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |