C10H21N3O — CID 62367973
4-(hydroxymethyl)-N'-propylpiperidine-1-carboximidamide (PubChem CID 62367973) has the molecular formula C10H21N3O and a molecular weight of 199.30 g/mol. Its IUPAC name is 4-(hydroxymethyl)-N'-propylpiperidine-1-carboximidamide.
| Compound Name | 4-(hydroxymethyl)-N'-propylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 62367973 |
| Molecular Formula | C10H21N3O |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.17 |
| IUPAC Name | 4-(hydroxymethyl)-N'-propylpiperidine-1-carboximidamide |
| SMILES | CCC/N=C(\N)N1CCC(CO)CC1 |
| InChI | InChI=1S/C10H21N3O/c1-2-5-12-10(11)13-6-3-9(8-14)4-7-13/h9,14H,2-8H2,1H3,(H2,11,12) |
| InChIKey | VDOVYWMFJHGJSC-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|