About 5-chloro-7-methyl-1,3-benzoxazol-2-amine
5-chloro-7-methyl-1,3-benzoxazol-2-amine (PubChem CID 62368889) has the molecular formula C8H7ClN2O
and a molecular weight of 182.61 g/mol. Its IUPAC name is 5-chloro-7-methyl-1,3-benzoxazol-2-amine.
Molecular Properties
| Compound Name | 5-chloro-7-methyl-1,3-benzoxazol-2-amine |
| PubChem CID | 62368889 |
| Molecular Formula | C8H7ClN2O |
| Molecular Weight | 182.61 g/mol |
| Exact Mass | 182.02 |
| IUPAC Name | 5-chloro-7-methyl-1,3-benzoxazol-2-amine |
| SMILES | Cc1cc(Cl)cc2nc(N)oc12 |
| InChI | InChI=1S/C8H7ClN2O/c1-4-2-5(9)3-6-7(4)12-8(10)11-6/h2-3H,1H3,(H2,10,11) |
| InChIKey | GJFBSBJBPSHPJC-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.61 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-chloro-7-methyl-1,3-benzoxazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-7-methyl-1,3-benzoxazol-2-amine?
The IUPAC name of 5-chloro-7-methyl-1,3-benzoxazol-2-amine (CID 62368889) is 5-chloro-7-methyl-1,3-benzoxazol-2-amine.
What is the SMILES notation for 5-chloro-7-methyl-1,3-benzoxazol-2-amine?
The canonical SMILES for 5-chloro-7-methyl-1,3-benzoxazol-2-amine is Cc1cc(Cl)cc2nc(N)oc12.
What is the InChIKey of 5-chloro-7-methyl-1,3-benzoxazol-2-amine?
The InChIKey is GJFBSBJBPSHPJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClN2O/c1-4-2-5(9)3-6-7(4)12-8(10)11-6/h2-3H,1H3,(H2,10,11).
What are the key properties of 5-chloro-7-methyl-1,3-benzoxazol-2-amine?
5-chloro-7-methyl-1,3-benzoxazol-2-amine has a molecular weight of 182.61 g/mol, XLogP of 2.37, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-7-methyl-1,3-benzoxazol-2-amine is sourced from PubChem (CID 62368889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).