C15H14BrF2NO — CID 62369042
1-[5-bromo-2-[(2,5-difluorophenyl)methoxy]phenyl]ethanamine (PubChem CID 62369042) has the molecular formula C15H14BrF2NO and a molecular weight of 342.18 g/mol. Its IUPAC name is 1-[5-bromo-2-[(2,5-difluorophenyl)methoxy]phenyl]ethanamine.
| Compound Name | 1-[5-bromo-2-[(2,5-difluorophenyl)methoxy]phenyl]ethanamine |
|---|---|
| PubChem CID | 62369042 |
| Molecular Formula | C15H14BrF2NO |
| Molecular Weight | 342.18 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | 1-[5-bromo-2-[(2,5-difluorophenyl)methoxy]phenyl]ethanamine |
| SMILES | CC(N)c1cc(Br)ccc1OCc1cc(F)ccc1F |
| InChI | InChI=1S/C15H14BrF2NO/c1-9(19)13-7-11(16)2-5-15(13)20-8-10-6-12(17)3-4-14(10)18/h2-7,9H,8,19H2,1H3 |
| InChIKey | CZMDWKGDPVNJNZ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.18 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |