C18H22O5 — CID 623708
3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthene-9-carboxylic acid (PubChem CID 623708) has the molecular formula C18H22O5 and a molecular weight of 318.37 g/mol. Its IUPAC name is 3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthene-9-carboxylic acid.
| Compound Name | 3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthene-9-carboxylic acid |
|---|---|
| PubChem CID | 623708 |
| Molecular Formula | C18H22O5 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthene-9-carboxylic acid |
| SMILES | CC1(C)CC(=O)C2=C(C1)OC1=C(C(=O)CC(C)(C)C1)C2C(=O)O |
| InChI | InChI=1S/C18H22O5/c1-17(2)5-9(19)13-11(7-17)23-12-8-18(3,4)6-10(20)14(12)15(13)16(21)22/h15H,5-8H2,1-4H3,(H,21,22) |
| InChIKey | PORLNLKSSGINMP-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |