About [1-(1H-pyrrolo[2,3-b]pyridin-3-ylsulfonyl)pyrrolidin-3-yl]methanol
[1-(1H-pyrrolo[2,3-b]pyridin-3-ylsulfonyl)pyrrolidin-3-yl]methanol (PubChem CID 62370984) has the molecular formula C12H15N3O3S
and a molecular weight of 281.34 g/mol. Its IUPAC name is [1-(1H-pyrrolo[2,3-b]pyridin-3-ylsulfonyl)pyrrolidin-3-yl]methanol.
Molecular Properties
| Compound Name | [1-(1H-pyrrolo[2,3-b]pyridin-3-ylsulfonyl)pyrrolidin-3-yl]methanol |
| PubChem CID | 62370984 |
| Molecular Formula | C12H15N3O3S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | [1-(1H-pyrrolo[2,3-b]pyridin-3-ylsulfonyl)pyrrolidin-3-yl]methanol |
| SMILES | O=S(=O)(c1c[nH]c2ncccc12)N1CCC(CO)C1 |
| InChI | InChI=1S/C12H15N3O3S/c16-8-9-3-5-15(7-9)19(17,18)11-6-14-12-10(11)2-1-4-13-12/h1-2,4,6,9,16H,3,5,7-8H2,(H,13,14) |
| InChIKey | NJKDVFICDCNXBT-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-(1H-pyrrolo[2,3-b]pyridin-3-ylsulfonyl)pyrrolidin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(1H-pyrrolo[2,3-b]pyridin-3-ylsulfonyl)pyrrolidin-3-yl]methanol?
The IUPAC name of [1-(1H-pyrrolo[2,3-b]pyridin-3-ylsulfonyl)pyrrolidin-3-yl]methanol (CID 62370984) is [1-(1H-pyrrolo[2,3-b]pyridin-3-ylsulfonyl)pyrrolidin-3-yl]methanol.
What is the SMILES notation for [1-(1H-pyrrolo[2,3-b]pyridin-3-ylsulfonyl)pyrrolidin-3-yl]methanol?
The canonical SMILES for [1-(1H-pyrrolo[2,3-b]pyridin-3-ylsulfonyl)pyrrolidin-3-yl]methanol is O=S(=O)(c1c[nH]c2ncccc12)N1CCC(CO)C1.
What is the InChIKey of [1-(1H-pyrrolo[2,3-b]pyridin-3-ylsulfonyl)pyrrolidin-3-yl]methanol?
The InChIKey is NJKDVFICDCNXBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O3S/c16-8-9-3-5-15(7-9)19(17,18)11-6-14-12-10(11)2-1-4-13-12/h1-2,4,6,9,16H,3,5,7-8H2,(H,13,14).
What are the key properties of [1-(1H-pyrrolo[2,3-b]pyridin-3-ylsulfonyl)pyrrolidin-3-yl]methanol?
[1-(1H-pyrrolo[2,3-b]pyridin-3-ylsulfonyl)pyrrolidin-3-yl]methanol has a molecular weight of 281.34 g/mol, XLogP of 0.57, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(1H-pyrrolo[2,3-b]pyridin-3-ylsulfonyl)pyrrolidin-3-yl]methanol is sourced from PubChem (CID 62370984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).