C7H12N4S — CID 62371632
5-(pyrrolidin-3-ylmethylsulfanyl)-1H-1,2,4-triazole (PubChem CID 62371632) has the molecular formula C7H12N4S and a molecular weight of 184.27 g/mol. Its IUPAC name is 5-(pyrrolidin-3-ylmethylsulfanyl)-1H-1,2,4-triazole.
| Compound Name | 5-(pyrrolidin-3-ylmethylsulfanyl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 62371632 |
| Molecular Formula | C7H12N4S |
| Molecular Weight | 184.27 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 5-(pyrrolidin-3-ylmethylsulfanyl)-1H-1,2,4-triazole |
| SMILES | c1n[nH]c(SCC2CCNC2)n1 |
| InChI | InChI=1S/C7H12N4S/c1-2-8-3-6(1)4-12-7-9-5-10-11-7/h5-6,8H,1-4H2,(H,9,10,11) |
| InChIKey | SGJLCQCEOLACDH-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.27 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |