C12H15BrFNO — CID 62371729
[1-[(5-bromo-2-fluorophenyl)methyl]pyrrolidin-3-yl]methanol (PubChem CID 62371729) has the molecular formula C12H15BrFNO and a molecular weight of 288.16 g/mol. Its IUPAC name is [1-[(5-bromo-2-fluorophenyl)methyl]pyrrolidin-3-yl]methanol.
| Compound Name | [1-[(5-bromo-2-fluorophenyl)methyl]pyrrolidin-3-yl]methanol |
|---|---|
| PubChem CID | 62371729 |
| Molecular Formula | C12H15BrFNO |
| Molecular Weight | 288.16 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | [1-[(5-bromo-2-fluorophenyl)methyl]pyrrolidin-3-yl]methanol |
| SMILES | OCC1CCN(Cc2cc(Br)ccc2F)C1 |
| InChI | InChI=1S/C12H15BrFNO/c13-11-1-2-12(14)10(5-11)7-15-4-3-9(6-15)8-16/h1-2,5,9,16H,3-4,6-8H2 |
| InChIKey | WRKRNQPGJDDNSY-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.16 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |