C14H21N — CID 62373433
7-ethyl-1-propyl-1,2,3,4-tetrahydroisoquinoline (PubChem CID 62373433) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is 7-ethyl-1-propyl-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 7-ethyl-1-propyl-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 62373433 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 7-ethyl-1-propyl-1,2,3,4-tetrahydroisoquinoline |
| SMILES | CCCC1NCCc2ccc(CC)cc21 |
| InChI | InChI=1S/C14H21N/c1-3-5-14-13-10-11(4-2)6-7-12(13)8-9-15-14/h6-7,10,14-15H,3-5,8-9H2,1-2H3 |
| InChIKey | FKMFLXUYAYQUHZ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |