C16H25NO3 — CID 62373438
1-tert-butyl-5,7,8-trimethoxy-1,2,3,4-tetrahydroisoquinoline (PubChem CID 62373438) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is 1-tert-butyl-5,7,8-trimethoxy-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 1-tert-butyl-5,7,8-trimethoxy-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 62373438 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | 1-tert-butyl-5,7,8-trimethoxy-1,2,3,4-tetrahydroisoquinoline |
| SMILES | COc1cc(OC)c(OC)c2c1CCNC2C(C)(C)C |
| InChI | InChI=1S/C16H25NO3/c1-16(2,3)15-13-10(7-8-17-15)11(18-4)9-12(19-5)14(13)20-6/h9,15,17H,7-8H2,1-6H3 |
| InChIKey | UQKOQISUXZXLJD-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |