C12H13Cl2N — CID 62373756
5,7-dichloro-1-cyclopropyl-1,2,3,4-tetrahydroisoquinoline (PubChem CID 62373756) has the molecular formula C12H13Cl2N and a molecular weight of 242.15 g/mol. Its IUPAC name is 5,7-dichloro-1-cyclopropyl-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 5,7-dichloro-1-cyclopropyl-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 62373756 |
| Molecular Formula | C12H13Cl2N |
| Molecular Weight | 242.15 g/mol |
| Exact Mass | 241.04 |
| IUPAC Name | 5,7-dichloro-1-cyclopropyl-1,2,3,4-tetrahydroisoquinoline |
| SMILES | Clc1cc(Cl)c2c(c1)C(C1CC1)NCC2 |
| InChI | InChI=1S/C12H13Cl2N/c13-8-5-10-9(11(14)6-8)3-4-15-12(10)7-1-2-7/h5-7,12,15H,1-4H2 |
| InChIKey | XRORQJASKRMFET-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.15 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |